C23H21Cl2F3N8O3 — CID 145476622
methyl 2-amino-6-[2-[[7-(2,4-dichlorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]amino]ethylamino]pyridine-3-carboxylate;1,1,1-trifluoropropan-2-one (PubChem CID 145476622) has the molecular formula C23H21Cl2F3N8O3 and a molecular weight of 585.37 g/mol. Its IUPAC name is methyl 2-amino-6-[2-[[7-(2,4-dichlorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]amino]ethylamino]pyridine-3-carboxylate;1,1,1-trifluoropropan-2-one.
| Compound Name | methyl 2-amino-6-[2-[[7-(2,4-dichlorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]amino]ethylamino]pyridine-3-carboxylate;1,1,1-trifluoropropan-2-one |
|---|---|
| PubChem CID | 145476622 |
| Molecular Formula | C23H21Cl2F3N8O3 |
| Molecular Weight | 585.37 g/mol |
| Exact Mass | 584.11 |
| IUPAC Name | methyl 2-amino-6-[2-[[7-(2,4-dichlorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]amino]ethylamino]pyridine-3-carboxylate;1,1,1-trifluoropropan-2-one |
| SMILES | CC(=O)C(F)(F)F.COC(=O)c1ccc(NCCNc2nc(-c3ccc(Cl)cc3Cl)cc3ncnn23)nc1N |
| InChI | InChI=1S/C20H18Cl2N8O2.C3H3F3O/c1-32-19(31)13-4-5-16(29-18(13)23)24-6-7-25-20-28-15(9-17-26-10-27-30(17)20)12-3-2-11(21)8-14(12)22;1-2(7)3(4,5)6/h2-5,8-10H,6-7H2,1H3,(H,25,28)(H3,23,24,29);1H3 |
| InChIKey | BFMDALGHNJPCRB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 149.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|