C21H15Cl2F3N6O — CID 159092022
1-[6-[3-[[7-(2,4-dichlorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]amino]propyl]-3-pyridinyl]-2,2,2-trifluoroethanone (PubChem CID 159092022) has the molecular formula C21H15Cl2F3N6O and a molecular weight of 495.29 g/mol. Its IUPAC name is 1-[6-[3-[[7-(2,4-dichlorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]amino]propyl]-3-pyridinyl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[6-[3-[[7-(2,4-dichlorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]amino]propyl]-3-pyridinyl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 159092022 |
| Molecular Formula | C21H15Cl2F3N6O |
| Molecular Weight | 495.29 g/mol |
| Exact Mass | 494.06 |
| IUPAC Name | 1-[6-[3-[[7-(2,4-dichlorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]amino]propyl]-3-pyridinyl]-2,2,2-trifluoroethanone |
| SMILES | O=C(c1ccc(CCCNc2nc(-c3ccc(Cl)cc3Cl)cc3ncnn23)nc1)C(F)(F)F |
| InChI | InChI=1S/C21H15Cl2F3N6O/c22-13-4-6-15(16(23)8-13)17-9-18-29-11-30-32(18)20(31-17)27-7-1-2-14-5-3-12(10-28-14)19(33)21(24,25)26/h3-6,8-11H,1-2,7H2,(H,27,31) |
| InChIKey | KCEKEIOJUOUZQZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.29 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|