C15H15Cl2N5 — CID 133356087
N-[3-(2,4-dichlorophenyl)propyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 133356087) has the molecular formula C15H15Cl2N5 and a molecular weight of 336.23 g/mol. Its IUPAC name is N-[3-(2,4-dichlorophenyl)propyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-[3-(2,4-dichlorophenyl)propyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 133356087 |
| Molecular Formula | C15H15Cl2N5 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | N-[3-(2,4-dichlorophenyl)propyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1cc(NCCCc2ccc(Cl)cc2Cl)n2ncnc2n1 |
| InChI | InChI=1S/C15H15Cl2N5/c1-10-7-14(22-15(21-10)19-9-20-22)18-6-2-3-11-4-5-12(16)8-13(11)17/h4-5,7-9,18H,2-3,6H2,1H3 |
| InChIKey | FLGNLSASYDPUDI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|