C11H16ClN5 — CID 107320766
N-(5-chloropentyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 107320766) has the molecular formula C11H16ClN5 and a molecular weight of 253.74 g/mol. Its IUPAC name is N-(5-chloropentyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-(5-chloropentyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 107320766 |
| Molecular Formula | C11H16ClN5 |
| Molecular Weight | 253.74 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-(5-chloropentyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1cc(NCCCCCCl)n2ncnc2n1 |
| InChI | InChI=1S/C11H16ClN5/c1-9-7-10(13-6-4-2-3-5-12)17-11(16-9)14-8-15-17/h7-8,13H,2-6H2,1H3 |
| InChIKey | FOUPXMAIDQKSGM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.74 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|