C13H19N5O2 — CID 39772396
methyl 6-[(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]hexanoate (PubChem CID 39772396) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is methyl 6-[(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]hexanoate.
| Compound Name | methyl 6-[(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]hexanoate |
|---|---|
| PubChem CID | 39772396 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | methyl 6-[(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]hexanoate |
| SMILES | COC(=O)CCCCCNc1cc(C)nc2ncnn12 |
| InChI | InChI=1S/C13H19N5O2/c1-10-8-11(18-13(17-10)15-9-16-18)14-7-5-3-4-6-12(19)20-2/h8-9,14H,3-7H2,1-2H3 |
| InChIKey | AHLFAXDLOGKCEX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|