C10H12F3N5 — CID 79040439
5-methyl-N-(4,4,4-trifluorobutyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 79040439) has the molecular formula C10H12F3N5 and a molecular weight of 259.23 g/mol. Its IUPAC name is 5-methyl-N-(4,4,4-trifluorobutyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-methyl-N-(4,4,4-trifluorobutyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 79040439 |
| Molecular Formula | C10H12F3N5 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 5-methyl-N-(4,4,4-trifluorobutyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1cc(NCCCC(F)(F)F)n2ncnc2n1 |
| InChI | InChI=1S/C10H12F3N5/c1-7-5-8(14-4-2-3-10(11,12)13)18-9(17-7)15-6-16-18/h5-6,14H,2-4H2,1H3 |
| InChIKey | IJDOWHHMIIUTFJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|