C13H20ClN5 — CID 106117285
N-[2-(2-chloroethyl)pentyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 106117285) has the molecular formula C13H20ClN5 and a molecular weight of 281.79 g/mol. Its IUPAC name is N-[2-(2-chloroethyl)pentyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-[2-(2-chloroethyl)pentyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 106117285 |
| Molecular Formula | C13H20ClN5 |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-[2-(2-chloroethyl)pentyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCCC(CCCl)CNc1cc(C)nc2ncnn12 |
| InChI | InChI=1S/C13H20ClN5/c1-3-4-11(5-6-14)8-15-12-7-10(2)18-13-16-9-17-19(12)13/h7,9,11,15H,3-6,8H2,1-2H3 |
| InChIKey | JMODNIBQLQFMFF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|