C13H14ClN7 — CID 133354346
N-(5-chloro-2-pyridinyl)-N'-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)ethane-1,2-diamine (PubChem CID 133354346) has the molecular formula C13H14ClN7 and a molecular weight of 303.76 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-N'-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)ethane-1,2-diamine.
| Compound Name | N-(5-chloro-2-pyridinyl)-N'-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 133354346 |
| Molecular Formula | C13H14ClN7 |
| Molecular Weight | 303.76 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-N'-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)ethane-1,2-diamine |
| SMILES | Cc1cc(NCCNc2ccc(Cl)cn2)n2ncnc2n1 |
| InChI | InChI=1S/C13H14ClN7/c1-9-6-12(21-13(20-9)18-8-19-21)16-5-4-15-11-3-2-10(14)7-17-11/h2-3,6-8,16H,4-5H2,1H3,(H,15,17) |
| InChIKey | BRXHNGAKUMILCI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 80.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.76 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|