C15H14ClN7 — CID 133354454
3-chloro-2-[2-[(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]ethylamino]benzonitrile (PubChem CID 133354454) has the molecular formula C15H14ClN7 and a molecular weight of 327.78 g/mol. Its IUPAC name is 3-chloro-2-[2-[(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]ethylamino]benzonitrile.
| Compound Name | 3-chloro-2-[2-[(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]ethylamino]benzonitrile |
|---|---|
| PubChem CID | 133354454 |
| Molecular Formula | C15H14ClN7 |
| Molecular Weight | 327.78 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 3-chloro-2-[2-[(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]ethylamino]benzonitrile |
| SMILES | Cc1cc(NCCNc2c(Cl)cccc2C#N)n2ncnc2n1 |
| InChI | InChI=1S/C15H14ClN7/c1-10-7-13(23-15(22-10)20-9-21-23)18-5-6-19-14-11(8-17)3-2-4-12(14)16/h2-4,7,9,18-19H,5-6H2,1H3 |
| InChIKey | QRBKGNDYRXRSPB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.78 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|