C14H14BrN5O — CID 133270163
N-[2-(3-bromophenoxy)ethyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 133270163) has the molecular formula C14H14BrN5O and a molecular weight of 348.20 g/mol. Its IUPAC name is N-[2-(3-bromophenoxy)ethyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-[2-(3-bromophenoxy)ethyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 133270163 |
| Molecular Formula | C14H14BrN5O |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | N-[2-(3-bromophenoxy)ethyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1cc(NCCOc2cccc(Br)c2)n2ncnc2n1 |
| InChI | InChI=1S/C14H14BrN5O/c1-10-7-13(20-14(19-10)17-9-18-20)16-5-6-21-12-4-2-3-11(15)8-12/h2-4,7-9,16H,5-6H2,1H3 |
| InChIKey | VJJAPFJSRXQYRK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|