C13H12ClN5O — CID 102918665
5-chloro-N-(2-phenoxyethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 102918665) has the molecular formula C13H12ClN5O and a molecular weight of 289.73 g/mol. Its IUPAC name is 5-chloro-N-(2-phenoxyethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-chloro-N-(2-phenoxyethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 102918665 |
| Molecular Formula | C13H12ClN5O |
| Molecular Weight | 289.73 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 5-chloro-N-(2-phenoxyethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Clc1cc(NCCOc2ccccc2)n2ncnc2n1 |
| InChI | InChI=1S/C13H12ClN5O/c14-11-8-12(19-13(18-11)16-9-17-19)15-6-7-20-10-4-2-1-3-5-10/h1-5,8-9,15H,6-7H2 |
| InChIKey | HLQUMEDJLPLLAV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.73 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|