C19H18Cl2N8 — CID 71065495
2-N-[2-[[7-(2,4-dichlorophenyl)-2-methyl-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]amino]ethyl]pyridine-2,5-diamine (PubChem CID 71065495) has the molecular formula C19H18Cl2N8 and a molecular weight of 429.32 g/mol. Its IUPAC name is 2-N-[2-[[7-(2,4-dichlorophenyl)-2-methyl-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]amino]ethyl]pyridine-2,5-diamine.
| Compound Name | 2-N-[2-[[7-(2,4-dichlorophenyl)-2-methyl-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]amino]ethyl]pyridine-2,5-diamine |
|---|---|
| PubChem CID | 71065495 |
| Molecular Formula | C19H18Cl2N8 |
| Molecular Weight | 429.32 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 2-N-[2-[[7-(2,4-dichlorophenyl)-2-methyl-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]amino]ethyl]pyridine-2,5-diamine |
| SMILES | Cc1nc2cc(-c3ccc(Cl)cc3Cl)nc(NCCNc3ccc(N)cn3)n2n1 |
| InChI | InChI=1S/C19H18Cl2N8/c1-11-26-18-9-16(14-4-2-12(20)8-15(14)21)27-19(29(18)28-11)24-7-6-23-17-5-3-13(22)10-25-17/h2-5,8-10H,6-7,22H2,1H3,(H,23,25)(H,24,27) |
| InChIKey | MSZTYOCITMWSLF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 106.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.32 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|