C13H9Cl2NO2 — CID 118824898
2-(2,4-dichlorophenyl)-5-methylpyridine-4-carboxylic acid (PubChem CID 118824898) has the molecular formula C13H9Cl2NO2 and a molecular weight of 282.13 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-5-methylpyridine-4-carboxylic acid.
| Compound Name | 2-(2,4-dichlorophenyl)-5-methylpyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 118824898 |
| Molecular Formula | C13H9Cl2NO2 |
| Molecular Weight | 282.13 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-5-methylpyridine-4-carboxylic acid |
| SMILES | Cc1cnc(-c2ccc(Cl)cc2Cl)cc1C(=O)O |
| InChI | InChI=1S/C13H9Cl2NO2/c1-7-6-16-12(5-10(7)13(17)18)9-3-2-8(14)4-11(9)15/h2-6H,1H3,(H,17,18) |
| InChIKey | YQMOJLJFCGBZEM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.13 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |