C12H5Cl3FNO2 — CID 133088789
5-fluoro-2-(2,4,5-trichlorophenyl)pyridine-4-carboxylic acid (PubChem CID 133088789) has the molecular formula C12H5Cl3FNO2 and a molecular weight of 320.53 g/mol. Its IUPAC name is 5-fluoro-2-(2,4,5-trichlorophenyl)pyridine-4-carboxylic acid.
| Compound Name | 5-fluoro-2-(2,4,5-trichlorophenyl)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 133088789 |
| Molecular Formula | C12H5Cl3FNO2 |
| Molecular Weight | 320.53 g/mol |
| Exact Mass | 318.94 |
| IUPAC Name | 5-fluoro-2-(2,4,5-trichlorophenyl)pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cc(Cl)c(Cl)cc2Cl)ncc1F |
| InChI | InChI=1S/C12H5Cl3FNO2/c13-7-3-9(15)8(14)1-5(7)11-2-6(12(18)19)10(16)4-17-11/h1-4H,(H,18,19) |
| InChIKey | XWPPBBZNWHONOM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|