C23H8Cl9N — CID 134637766
2,4,5-tris(2,4,5-trichlorophenyl)pyridine (PubChem CID 134637766) has the molecular formula C23H8Cl9N and a molecular weight of 617.40 g/mol. Its IUPAC name is 2,4,5-tris(2,4,5-trichlorophenyl)pyridine.
| Compound Name | 2,4,5-tris(2,4,5-trichlorophenyl)pyridine |
|---|---|
| PubChem CID | 134637766 |
| Molecular Formula | C23H8Cl9N |
| Molecular Weight | 617.40 g/mol |
| Exact Mass | 612.79 |
| IUPAC Name | 2,4,5-tris(2,4,5-trichlorophenyl)pyridine |
| SMILES | Clc1cc(Cl)c(-c2cc(-c3cc(Cl)c(Cl)cc3Cl)c(-c3cc(Cl)c(Cl)cc3Cl)cn2)cc1Cl |
| InChI | InChI=1S/C23H8Cl9N/c24-14-5-20(30)17(27)1-10(14)9-4-23(12-3-19(29)22(32)7-16(12)26)33-8-13(9)11-2-18(28)21(31)6-15(11)25/h1-8H |
| InChIKey | XSLPASSWPUUONO-UHFFFAOYSA-N |
| XLogP | 11.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.40 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|