C18H9Cl6NO — CID 134623378
[3,5-bis(2,4,5-trichlorophenyl)-2-pyridinyl]methanol (PubChem CID 134623378) has the molecular formula C18H9Cl6NO and a molecular weight of 467.99 g/mol. Its IUPAC name is [3,5-bis(2,4,5-trichlorophenyl)-2-pyridinyl]methanol.
| Compound Name | [3,5-bis(2,4,5-trichlorophenyl)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 134623378 |
| Molecular Formula | C18H9Cl6NO |
| Molecular Weight | 467.99 g/mol |
| Exact Mass | 464.88 |
| IUPAC Name | [3,5-bis(2,4,5-trichlorophenyl)-2-pyridinyl]methanol |
| SMILES | OCc1ncc(-c2cc(Cl)c(Cl)cc2Cl)cc1-c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H9Cl6NO/c19-12-4-16(23)14(21)2-9(12)8-1-11(18(7-26)25-6-8)10-3-15(22)17(24)5-13(10)20/h1-6,26H,7H2 |
| InChIKey | QVHONIHELNMPCS-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.99 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|