C12H9Cl3N2O — CID 133086599
[2-amino-3-(2,4,5-trichlorophenyl)-4-pyridinyl]methanol (PubChem CID 133086599) has the molecular formula C12H9Cl3N2O and a molecular weight of 303.58 g/mol. Its IUPAC name is [2-amino-3-(2,4,5-trichlorophenyl)-4-pyridinyl]methanol.
| Compound Name | [2-amino-3-(2,4,5-trichlorophenyl)-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 133086599 |
| Molecular Formula | C12H9Cl3N2O |
| Molecular Weight | 303.58 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | [2-amino-3-(2,4,5-trichlorophenyl)-4-pyridinyl]methanol |
| SMILES | Nc1nccc(CO)c1-c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H9Cl3N2O/c13-8-4-10(15)9(14)3-7(8)11-6(5-18)1-2-17-12(11)16/h1-4,18H,5H2,(H2,16,17) |
| InChIKey | VEBSMGJXTOIDKV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|