C13H6Cl3FN2 — CID 133093930
2-[2-fluoro-3-(2,4,5-trichlorophenyl)-4-pyridinyl]acetonitrile (PubChem CID 133093930) has the molecular formula C13H6Cl3FN2 and a molecular weight of 315.56 g/mol. Its IUPAC name is 2-[2-fluoro-3-(2,4,5-trichlorophenyl)-4-pyridinyl]acetonitrile.
| Compound Name | 2-[2-fluoro-3-(2,4,5-trichlorophenyl)-4-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 133093930 |
| Molecular Formula | C13H6Cl3FN2 |
| Molecular Weight | 315.56 g/mol |
| Exact Mass | 313.96 |
| IUPAC Name | 2-[2-fluoro-3-(2,4,5-trichlorophenyl)-4-pyridinyl]acetonitrile |
| SMILES | N#CCc1ccnc(F)c1-c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H6Cl3FN2/c14-9-6-11(16)10(15)5-8(9)12-7(1-3-18)2-4-19-13(12)17/h2,4-6H,1H2 |
| InChIKey | OKHPEUJFUAZCHX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|