C13H7Cl2FN2 — CID 133094509
2-[5-(2,4-dichlorophenyl)-2-fluoro-3-pyridinyl]acetonitrile (PubChem CID 133094509) has the molecular formula C13H7Cl2FN2 and a molecular weight of 281.12 g/mol. Its IUPAC name is 2-[5-(2,4-dichlorophenyl)-2-fluoro-3-pyridinyl]acetonitrile.
| Compound Name | 2-[5-(2,4-dichlorophenyl)-2-fluoro-3-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 133094509 |
| Molecular Formula | C13H7Cl2FN2 |
| Molecular Weight | 281.12 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | 2-[5-(2,4-dichlorophenyl)-2-fluoro-3-pyridinyl]acetonitrile |
| SMILES | N#CCc1cc(-c2ccc(Cl)cc2Cl)cnc1F |
| InChI | InChI=1S/C13H7Cl2FN2/c14-10-1-2-11(12(15)6-10)9-5-8(3-4-17)13(16)18-7-9/h1-2,5-7H,3H2 |
| InChIKey | BHQMLOHVRNVZEN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.12 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|