C13H8Cl2N2O — CID 133093069
2-[5-(2,4-dichlorophenyl)-2-oxo-1H-pyridin-3-yl]acetonitrile (PubChem CID 133093069) has the molecular formula C13H8Cl2N2O and a molecular weight of 279.13 g/mol. Its IUPAC name is 2-[5-(2,4-dichlorophenyl)-2-oxo-1H-pyridin-3-yl]acetonitrile.
| Compound Name | 2-[5-(2,4-dichlorophenyl)-2-oxo-1H-pyridin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 133093069 |
| Molecular Formula | C13H8Cl2N2O |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 2-[5-(2,4-dichlorophenyl)-2-oxo-1H-pyridin-3-yl]acetonitrile |
| SMILES | N#CCc1cc(-c2ccc(Cl)cc2Cl)c[nH]c1=O |
| InChI | InChI=1S/C13H8Cl2N2O/c14-10-1-2-11(12(15)6-10)9-5-8(3-4-16)13(18)17-7-9/h1-2,5-7H,3H2,(H,17,18) |
| InChIKey | XCCSNAQUXWJVJX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |