C12H9Cl2NO2 — CID 123499878
5-(2,4-dichlorophenyl)-3-hydroxy-4-methyl-1H-pyridin-2-one (PubChem CID 123499878) has the molecular formula C12H9Cl2NO2 and a molecular weight of 270.12 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-3-hydroxy-4-methyl-1H-pyridin-2-one.
| Compound Name | 5-(2,4-dichlorophenyl)-3-hydroxy-4-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 123499878 |
| Molecular Formula | C12H9Cl2NO2 |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-3-hydroxy-4-methyl-1H-pyridin-2-one |
| SMILES | Cc1c(-c2ccc(Cl)cc2Cl)c[nH]c(=O)c1O |
| InChI | InChI=1S/C12H9Cl2NO2/c1-6-9(5-15-12(17)11(6)16)8-3-2-7(13)4-10(8)14/h2-5,16H,1H3,(H,15,17) |
| InChIKey | SMVGWDFZHRUIRQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |