C13H9Cl2NO3 — CID 133093032
methyl 5-(2,4-dichlorophenyl)-2-oxo-1H-pyridine-3-carboxylate (PubChem CID 133093032) has the molecular formula C13H9Cl2NO3 and a molecular weight of 298.13 g/mol. Its IUPAC name is methyl 5-(2,4-dichlorophenyl)-2-oxo-1H-pyridine-3-carboxylate.
| Compound Name | methyl 5-(2,4-dichlorophenyl)-2-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 133093032 |
| Molecular Formula | C13H9Cl2NO3 |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | methyl 5-(2,4-dichlorophenyl)-2-oxo-1H-pyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccc(Cl)cc2Cl)c[nH]c1=O |
| InChI | InChI=1S/C13H9Cl2NO3/c1-19-13(18)10-4-7(6-16-12(10)17)9-3-2-8(14)5-11(9)15/h2-6H,1H3,(H,16,17) |
| InChIKey | XWKXCQBWRLEXAB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |