C14H11Cl2NO3 — CID 133093124
ethyl 5-(2,5-dichlorophenyl)-2-oxo-1H-pyridine-3-carboxylate (PubChem CID 133093124) has the molecular formula C14H11Cl2NO3 and a molecular weight of 312.15 g/mol. Its IUPAC name is ethyl 5-(2,5-dichlorophenyl)-2-oxo-1H-pyridine-3-carboxylate.
| Compound Name | ethyl 5-(2,5-dichlorophenyl)-2-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 133093124 |
| Molecular Formula | C14H11Cl2NO3 |
| Molecular Weight | 312.15 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | ethyl 5-(2,5-dichlorophenyl)-2-oxo-1H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cc(Cl)ccc2Cl)c[nH]c1=O |
| InChI | InChI=1S/C14H11Cl2NO3/c1-2-20-14(19)11-5-8(7-17-13(11)18)10-6-9(15)3-4-12(10)16/h3-7H,2H2,1H3,(H,17,18) |
| InChIKey | PALNGHFAXABYRR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.15 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |