C15H8Cl2F4O2 — CID 119005529
ethyl 4-(2,5-dichlorophenyl)-2,3,5,6-tetrafluorobenzoate (PubChem CID 119005529) has the molecular formula C15H8Cl2F4O2 and a molecular weight of 367.13 g/mol. Its IUPAC name is ethyl 4-(2,5-dichlorophenyl)-2,3,5,6-tetrafluorobenzoate.
| Compound Name | ethyl 4-(2,5-dichlorophenyl)-2,3,5,6-tetrafluorobenzoate |
|---|---|
| PubChem CID | 119005529 |
| Molecular Formula | C15H8Cl2F4O2 |
| Molecular Weight | 367.13 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | ethyl 4-(2,5-dichlorophenyl)-2,3,5,6-tetrafluorobenzoate |
| SMILES | CCOC(=O)c1c(F)c(F)c(-c2cc(Cl)ccc2Cl)c(F)c1F |
| InChI | InChI=1S/C15H8Cl2F4O2/c1-2-23-15(22)10-13(20)11(18)9(12(19)14(10)21)7-5-6(16)3-4-8(7)17/h3-5H,2H2,1H3 |
| InChIKey | KVBMAYOGDXSETC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.13 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|