About methyl 6-(2,4-dichlorophenyl)-5-methylpyridazine-3-carboxylate
methyl 6-(2,4-dichlorophenyl)-5-methylpyridazine-3-carboxylate (PubChem CID 15274283) has the molecular formula C13H10Cl2N2O2
and a molecular weight of 297.14 g/mol. Its IUPAC name is methyl 6-(2,4-dichlorophenyl)-5-methylpyridazine-3-carboxylate.
Analyze methyl 6-(2,4-dichlorophenyl)-5-methylpyridazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-(2,4-dichlorophenyl)-5-methylpyridazine-3-carboxylate?
The IUPAC name of methyl 6-(2,4-dichlorophenyl)-5-methylpyridazine-3-carboxylate (CID 15274283) is methyl 6-(2,4-dichlorophenyl)-5-methylpyridazine-3-carboxylate.
What is the SMILES notation for methyl 6-(2,4-dichlorophenyl)-5-methylpyridazine-3-carboxylate?
The canonical SMILES for methyl 6-(2,4-dichlorophenyl)-5-methylpyridazine-3-carboxylate is COC(=O)c1cc(C)c(-c2ccc(Cl)cc2Cl)nn1.
What is the InChIKey of methyl 6-(2,4-dichlorophenyl)-5-methylpyridazine-3-carboxylate?
The InChIKey is KQMYMPGZHAOKHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2N2O2/c1-7-5-11(13(18)19-2)16-17-12(7)9-4-3-8(14)6-10(9)15/h3-6H,1-2H3.
What are the key properties of methyl 6-(2,4-dichlorophenyl)-5-methylpyridazine-3-carboxylate?
methyl 6-(2,4-dichlorophenyl)-5-methylpyridazine-3-carboxylate has a molecular weight of 297.14 g/mol, XLogP of 3.55, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(2,4-dichlorophenyl)-5-methylpyridazine-3-carboxylate is sourced from PubChem (CID 15274283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).