C13H11Cl2N — CID 12513322
2-(2,4-dichlorophenyl)-3,5-dimethylpyridine (PubChem CID 12513322) has the molecular formula C13H11Cl2N and a molecular weight of 252.14 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-3,5-dimethylpyridine.
| Compound Name | 2-(2,4-dichlorophenyl)-3,5-dimethylpyridine |
|---|---|
| PubChem CID | 12513322 |
| Molecular Formula | C13H11Cl2N |
| Molecular Weight | 252.14 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-3,5-dimethylpyridine |
| SMILES | Cc1cnc(-c2ccc(Cl)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C13H11Cl2N/c1-8-5-9(2)13(16-7-8)11-4-3-10(14)6-12(11)15/h3-7H,1-2H3 |
| InChIKey | OXXYQOVVLTVBLM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.14 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |