C10H9Cl2N3 — CID 82477662
5-(2,4-dichlorophenyl)-2-methyl-1H-imidazol-4-amine (PubChem CID 82477662) has the molecular formula C10H9Cl2N3 and a molecular weight of 242.11 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-2-methyl-1H-imidazol-4-amine.
| Compound Name | 5-(2,4-dichlorophenyl)-2-methyl-1H-imidazol-4-amine |
|---|---|
| PubChem CID | 82477662 |
| Molecular Formula | C10H9Cl2N3 |
| Molecular Weight | 242.11 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-2-methyl-1H-imidazol-4-amine |
| SMILES | Cc1nc(N)c(-c2ccc(Cl)cc2Cl)[nH]1 |
| InChI | InChI=1S/C10H9Cl2N3/c1-5-14-9(10(13)15-5)7-3-2-6(11)4-8(7)12/h2-4H,13H2,1H3,(H,14,15) |
| InChIKey | QSYKBJSDUQFTOJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.11 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |