C13H13Cl2N3 — CID 142247147
5-(2,4-dichlorophenyl)-3-ethyl-6-methylpyrazin-2-amine (PubChem CID 142247147) has the molecular formula C13H13Cl2N3 and a molecular weight of 282.17 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-3-ethyl-6-methylpyrazin-2-amine.
| Compound Name | 5-(2,4-dichlorophenyl)-3-ethyl-6-methylpyrazin-2-amine |
|---|---|
| PubChem CID | 142247147 |
| Molecular Formula | C13H13Cl2N3 |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-3-ethyl-6-methylpyrazin-2-amine |
| SMILES | CCc1nc(-c2ccc(Cl)cc2Cl)c(C)nc1N |
| InChI | InChI=1S/C13H13Cl2N3/c1-3-11-13(16)17-7(2)12(18-11)9-5-4-8(14)6-10(9)15/h4-6H,3H2,1-2H3,(H2,16,17) |
| InChIKey | KCPOSQOESHWVSC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |