C17H20Cl2N2 — CID 90838020
2-(2,4-dichlorophenyl)-3,6-dimethyl-5-pentan-3-ylpyrazine (PubChem CID 90838020) has the molecular formula C17H20Cl2N2 and a molecular weight of 323.27 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-3,6-dimethyl-5-pentan-3-ylpyrazine.
| Compound Name | 2-(2,4-dichlorophenyl)-3,6-dimethyl-5-pentan-3-ylpyrazine |
|---|---|
| PubChem CID | 90838020 |
| Molecular Formula | C17H20Cl2N2 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-3,6-dimethyl-5-pentan-3-ylpyrazine |
| SMILES | CCC(CC)c1nc(C)c(-c2ccc(Cl)cc2Cl)nc1C |
| InChI | InChI=1S/C17H20Cl2N2/c1-5-12(6-2)16-10(3)21-17(11(4)20-16)14-8-7-13(18)9-15(14)19/h7-9,12H,5-6H2,1-4H3 |
| InChIKey | VNZRDGUKIVZCEF-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |