C26H35Cl2N5O — CID 142964718
5-(2,4-dichlorophenyl)-3,6-diethylpyrazin-2-amine;ethanol;3-piperidin-1-ylpyridine (PubChem CID 142964718) has the molecular formula C26H35Cl2N5O and a molecular weight of 504.51 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-3,6-diethylpyrazin-2-amine;ethanol;3-piperidin-1-ylpyridine.
| Compound Name | 5-(2,4-dichlorophenyl)-3,6-diethylpyrazin-2-amine;ethanol;3-piperidin-1-ylpyridine |
|---|---|
| PubChem CID | 142964718 |
| Molecular Formula | C26H35Cl2N5O |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-3,6-diethylpyrazin-2-amine;ethanol;3-piperidin-1-ylpyridine |
| SMILES | CCO.CCc1nc(-c2ccc(Cl)cc2Cl)c(CC)nc1N.c1cncc(N2CCCCC2)c1 |
| InChI | InChI=1S/C14H15Cl2N3.C10H14N2.C2H6O/c1-3-11-13(18-12(4-2)14(17)19-11)9-6-5-8(15)7-10(9)16;1-2-7-12(8-3-1)10-5-4-6-11-9-10;1-2-3/h5-7H,3-4H2,1-2H3,(H2,17,19);4-6,9H,1-3,7-8H2;3H,2H2,1H3 |
| InChIKey | JTTLDQYCQCDUGT-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |