C21H33Cl2N3O — CID 142247304
5-(2,4-dichlorophenyl)-3,6-diethylpyrazin-2-amine;ethanol;pentane (PubChem CID 142247304) has the molecular formula C21H33Cl2N3O and a molecular weight of 414.42 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-3,6-diethylpyrazin-2-amine;ethanol;pentane.
| Compound Name | 5-(2,4-dichlorophenyl)-3,6-diethylpyrazin-2-amine;ethanol;pentane |
|---|---|
| PubChem CID | 142247304 |
| Molecular Formula | C21H33Cl2N3O |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-3,6-diethylpyrazin-2-amine;ethanol;pentane |
| SMILES | CCCCC.CCO.CCc1nc(-c2ccc(Cl)cc2Cl)c(CC)nc1N |
| InChI | InChI=1S/C14H15Cl2N3.C5H12.C2H6O/c1-3-11-13(18-12(4-2)14(17)19-11)9-6-5-8(15)7-10(9)16;1-3-5-4-2;1-2-3/h5-7H,3-4H2,1-2H3,(H2,17,19);3-5H2,1-2H3;3H,2H2,1H3 |
| InChIKey | NDMXQDPOHIPGBJ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |