C11H9Cl2FN4 — CID 22372155
6-(2,4-dichlorophenyl)-5-(fluoromethyl)pyrimidine-2,4-diamine (PubChem CID 22372155) has the molecular formula C11H9Cl2FN4 and a molecular weight of 287.12 g/mol. Its IUPAC name is 6-(2,4-dichlorophenyl)-5-(fluoromethyl)pyrimidine-2,4-diamine.
| Compound Name | 6-(2,4-dichlorophenyl)-5-(fluoromethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 22372155 |
| Molecular Formula | C11H9Cl2FN4 |
| Molecular Weight | 287.12 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 6-(2,4-dichlorophenyl)-5-(fluoromethyl)pyrimidine-2,4-diamine |
| SMILES | Nc1nc(N)c(CF)c(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C11H9Cl2FN4/c12-5-1-2-6(8(13)3-5)9-7(4-14)10(15)18-11(16)17-9/h1-3H,4H2,(H4,15,16,17,18) |
| InChIKey | UJFJAUBWLFVCTN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.12 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |