C11H7Cl2N5 — CID 126962350
4-(2,4-dichlorophenyl)pyrazolo[5,1-f][1,2,4]triazin-2-amine (PubChem CID 126962350) has the molecular formula C11H7Cl2N5 and a molecular weight of 280.12 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)pyrazolo[5,1-f][1,2,4]triazin-2-amine.
| Compound Name | 4-(2,4-dichlorophenyl)pyrazolo[5,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 126962350 |
| Molecular Formula | C11H7Cl2N5 |
| Molecular Weight | 280.12 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 4-(2,4-dichlorophenyl)pyrazolo[5,1-f][1,2,4]triazin-2-amine |
| SMILES | Nc1nc(-c2ccc(Cl)cc2Cl)c2ccnn2n1 |
| InChI | InChI=1S/C11H7Cl2N5/c12-6-1-2-7(8(13)5-6)10-9-3-4-15-18(9)17-11(14)16-10/h1-5H,(H2,14,17) |
| InChIKey | VCXONGRHQFLTHL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.12 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |