C12H12Cl2N2 — CID 102416631
2-(2,4-dichlorophenyl)-1,4,5-trimethylimidazole (PubChem CID 102416631) has the molecular formula C12H12Cl2N2 and a molecular weight of 255.15 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1,4,5-trimethylimidazole.
| Compound Name | 2-(2,4-dichlorophenyl)-1,4,5-trimethylimidazole |
|---|---|
| PubChem CID | 102416631 |
| Molecular Formula | C12H12Cl2N2 |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1,4,5-trimethylimidazole |
| SMILES | Cc1nc(-c2ccc(Cl)cc2Cl)n(C)c1C |
| InChI | InChI=1S/C12H12Cl2N2/c1-7-8(2)16(3)12(15-7)10-5-4-9(13)6-11(10)14/h4-6H,1-3H3 |
| InChIKey | RCLZZSGOONVACU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |