C15H12Cl2N4 — CID 106753135
4-(2,4-dichlorophenyl)-5-(2-methyl-4-pyridinyl)-1H-pyrazol-3-amine (PubChem CID 106753135) has the molecular formula C15H12Cl2N4 and a molecular weight of 319.20 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-5-(2-methyl-4-pyridinyl)-1H-pyrazol-3-amine.
| Compound Name | 4-(2,4-dichlorophenyl)-5-(2-methyl-4-pyridinyl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 106753135 |
| Molecular Formula | C15H12Cl2N4 |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-5-(2-methyl-4-pyridinyl)-1H-pyrazol-3-amine |
| SMILES | Cc1cc(-c2[nH]nc(N)c2-c2ccc(Cl)cc2Cl)ccn1 |
| InChI | InChI=1S/C15H12Cl2N4/c1-8-6-9(4-5-19-8)14-13(15(18)21-20-14)11-3-2-10(16)7-12(11)17/h2-7H,1H3,(H3,18,20,21) |
| InChIKey | NGBWQDVEDIXFKY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |