C14H11Cl2N3O — CID 114821028
4-(2,4-dichlorophenyl)-5-(5-methylfuran-3-yl)-1H-pyrazol-3-amine (PubChem CID 114821028) has the molecular formula C14H11Cl2N3O and a molecular weight of 308.17 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-5-(5-methylfuran-3-yl)-1H-pyrazol-3-amine.
| Compound Name | 4-(2,4-dichlorophenyl)-5-(5-methylfuran-3-yl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 114821028 |
| Molecular Formula | C14H11Cl2N3O |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-5-(5-methylfuran-3-yl)-1H-pyrazol-3-amine |
| SMILES | Cc1cc(-c2[nH]nc(N)c2-c2ccc(Cl)cc2Cl)co1 |
| InChI | InChI=1S/C14H11Cl2N3O/c1-7-4-8(6-20-7)13-12(14(17)19-18-13)10-3-2-9(15)5-11(10)16/h2-6H,1H3,(H3,17,18,19) |
| InChIKey | UWAOVPWQZMOMSD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |