C14H12ClN3O — CID 114821013
4-(3-chlorophenyl)-5-(5-methylfuran-3-yl)-1H-pyrazol-3-amine (PubChem CID 114821013) has the molecular formula C14H12ClN3O and a molecular weight of 273.72 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-5-(5-methylfuran-3-yl)-1H-pyrazol-3-amine.
| Compound Name | 4-(3-chlorophenyl)-5-(5-methylfuran-3-yl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 114821013 |
| Molecular Formula | C14H12ClN3O |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 4-(3-chlorophenyl)-5-(5-methylfuran-3-yl)-1H-pyrazol-3-amine |
| SMILES | Cc1cc(-c2[nH]nc(N)c2-c2cccc(Cl)c2)co1 |
| InChI | InChI=1S/C14H12ClN3O/c1-8-5-10(7-19-8)13-12(14(16)18-17-13)9-3-2-4-11(15)6-9/h2-7H,1H3,(H3,16,17,18) |
| InChIKey | MVJRQQDHLSGDLV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |