About 6-(2,4-dichlorophenyl)-2-methylpyrido[2,3-d]pyrimidin-7-amine
6-(2,4-dichlorophenyl)-2-methylpyrido[2,3-d]pyrimidin-7-amine (PubChem CID 12904746) has the molecular formula C14H10Cl2N4
and a molecular weight of 305.17 g/mol. Its IUPAC name is 6-(2,4-dichlorophenyl)-2-methylpyrido[2,3-d]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 6-(2,4-dichlorophenyl)-2-methylpyrido[2,3-d]pyrimidin-7-amine |
| PubChem CID | 12904746 |
| Molecular Formula | C14H10Cl2N4 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 6-(2,4-dichlorophenyl)-2-methylpyrido[2,3-d]pyrimidin-7-amine |
| SMILES | Cc1ncc2cc(-c3ccc(Cl)cc3Cl)c(N)nc2n1 |
| InChI | InChI=1S/C14H10Cl2N4/c1-7-18-6-8-4-11(13(17)20-14(8)19-7)10-3-2-9(15)5-12(10)16/h2-6H,1H3,(H2,17,18,19,20) |
| InChIKey | DCUIRBHRYGZTMB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(2,4-dichlorophenyl)-2-methylpyrido[2,3-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,4-dichlorophenyl)-2-methylpyrido[2,3-d]pyrimidin-7-amine?
The IUPAC name of 6-(2,4-dichlorophenyl)-2-methylpyrido[2,3-d]pyrimidin-7-amine (CID 12904746) is 6-(2,4-dichlorophenyl)-2-methylpyrido[2,3-d]pyrimidin-7-amine.
What is the SMILES notation for 6-(2,4-dichlorophenyl)-2-methylpyrido[2,3-d]pyrimidin-7-amine?
The canonical SMILES for 6-(2,4-dichlorophenyl)-2-methylpyrido[2,3-d]pyrimidin-7-amine is Cc1ncc2cc(-c3ccc(Cl)cc3Cl)c(N)nc2n1.
What is the InChIKey of 6-(2,4-dichlorophenyl)-2-methylpyrido[2,3-d]pyrimidin-7-amine?
The InChIKey is DCUIRBHRYGZTMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2N4/c1-7-18-6-8-4-11(13(17)20-14(8)19-7)10-3-2-9(15)5-12(10)16/h2-6H,1H3,(H2,17,18,19,20).
What are the key properties of 6-(2,4-dichlorophenyl)-2-methylpyrido[2,3-d]pyrimidin-7-amine?
6-(2,4-dichlorophenyl)-2-methylpyrido[2,3-d]pyrimidin-7-amine has a molecular weight of 305.17 g/mol, XLogP of 3.89, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,4-dichlorophenyl)-2-methylpyrido[2,3-d]pyrimidin-7-amine is sourced from PubChem (CID 12904746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).