C13H10Cl2O — CID 83130752
2-(2,4-dichlorophenyl)-4-methylphenol (PubChem CID 83130752) has the molecular formula C13H10Cl2O and a molecular weight of 253.13 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-4-methylphenol.
| Compound Name | 2-(2,4-dichlorophenyl)-4-methylphenol |
|---|---|
| PubChem CID | 83130752 |
| Molecular Formula | C13H10Cl2O |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-4-methylphenol |
| SMILES | Cc1ccc(O)c(-c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C13H10Cl2O/c1-8-2-5-13(16)11(6-8)10-4-3-9(14)7-12(10)15/h2-7,16H,1H3 |
| InChIKey | HKWDKQLAWMGRLI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |