About 4-chloro-2-(2,5-dimethylphenyl)phenol
4-chloro-2-(2,5-dimethylphenyl)phenol (PubChem CID 83130826) has the molecular formula C14H13ClO
and a molecular weight of 232.71 g/mol. Its IUPAC name is 4-chloro-2-(2,5-dimethylphenyl)phenol.
Molecular Properties
| Compound Name | 4-chloro-2-(2,5-dimethylphenyl)phenol |
| PubChem CID | 83130826 |
| Molecular Formula | C14H13ClO |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 4-chloro-2-(2,5-dimethylphenyl)phenol |
| SMILES | Cc1ccc(C)c(-c2cc(Cl)ccc2O)c1 |
| InChI | InChI=1S/C14H13ClO/c1-9-3-4-10(2)12(7-9)13-8-11(15)5-6-14(13)16/h3-8,16H,1-2H3 |
| InChIKey | LBCAIYXVGGXLIY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-2-(2,5-dimethylphenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(2,5-dimethylphenyl)phenol?
The IUPAC name of 4-chloro-2-(2,5-dimethylphenyl)phenol (CID 83130826) is 4-chloro-2-(2,5-dimethylphenyl)phenol.
What is the SMILES notation for 4-chloro-2-(2,5-dimethylphenyl)phenol?
The canonical SMILES for 4-chloro-2-(2,5-dimethylphenyl)phenol is Cc1ccc(C)c(-c2cc(Cl)ccc2O)c1.
What is the InChIKey of 4-chloro-2-(2,5-dimethylphenyl)phenol?
The InChIKey is LBCAIYXVGGXLIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClO/c1-9-3-4-10(2)12(7-9)13-8-11(15)5-6-14(13)16/h3-8,16H,1-2H3.
What are the key properties of 4-chloro-2-(2,5-dimethylphenyl)phenol?
4-chloro-2-(2,5-dimethylphenyl)phenol has a molecular weight of 232.71 g/mol, XLogP of 4.33, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(2,5-dimethylphenyl)phenol is sourced from PubChem (CID 83130826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).