C16H17Cl3O2 — CID 67248673
5-chloro-2-(2,4-dichlorophenyl)phenol;ethoxyethane (PubChem CID 67248673) has the molecular formula C16H17Cl3O2 and a molecular weight of 347.67 g/mol. Its IUPAC name is 5-chloro-2-(2,4-dichlorophenyl)phenol;ethoxyethane.
| Compound Name | 5-chloro-2-(2,4-dichlorophenyl)phenol;ethoxyethane |
|---|---|
| PubChem CID | 67248673 |
| Molecular Formula | C16H17Cl3O2 |
| Molecular Weight | 347.67 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 5-chloro-2-(2,4-dichlorophenyl)phenol;ethoxyethane |
| SMILES | CCOCC.Oc1cc(Cl)ccc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H7Cl3O.C4H10O/c13-7-1-3-9(11(15)5-7)10-4-2-8(14)6-12(10)16;1-3-5-4-2/h1-6,16H;3-4H2,1-2H3 |
| InChIKey | MEYCLKNXEOECNZ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.67 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |