C11H13Cl2NO — CID 76787512
1-(2,4-dichlorophenyl)-N-ethoxypropan-2-imine (PubChem CID 76787512) has the molecular formula C11H13Cl2NO and a molecular weight of 246.14 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-ethoxypropan-2-imine.
| Compound Name | 1-(2,4-dichlorophenyl)-N-ethoxypropan-2-imine |
|---|---|
| PubChem CID | 76787512 |
| Molecular Formula | C11H13Cl2NO |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-ethoxypropan-2-imine |
| SMILES | CCON=C(C)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H13Cl2NO/c1-3-15-14-8(2)6-9-4-5-10(12)7-11(9)13/h4-5,7H,3,6H2,1-2H3 |
| InChIKey | LZZHBIQKIWXTHQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|