About (2Z)-2-[(2,4-dichlorophenyl)methoxyimino]-3-oxobutanoic acid
(2Z)-2-[(2,4-dichlorophenyl)methoxyimino]-3-oxobutanoic acid (PubChem CID 88719702) has the molecular formula C11H9Cl2NO4
and a molecular weight of 290.10 g/mol. Its IUPAC name is (2Z)-2-[(2,4-dichlorophenyl)methoxyimino]-3-oxobutanoic acid.
Molecular Properties
| Compound Name | (2Z)-2-[(2,4-dichlorophenyl)methoxyimino]-3-oxobutanoic acid |
| PubChem CID | 88719702 |
| Molecular Formula | C11H9Cl2NO4 |
| Molecular Weight | 290.10 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | (2Z)-2-[(2,4-dichlorophenyl)methoxyimino]-3-oxobutanoic acid |
| SMILES | CC(=O)/C(=N/OCc1ccc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C11H9Cl2NO4/c1-6(15)10(11(16)17)14-18-5-7-2-3-8(12)4-9(7)13/h2-4H,5H2,1H3,(H,16,17)/b14-10- |
| InChIKey | FGSSRNJGNDMRKW-UVTDQMKNSA-N |
| XLogP | 2.54 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.10 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-[(2,4-dichlorophenyl)methoxyimino]-3-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-[(2,4-dichlorophenyl)methoxyimino]-3-oxobutanoic acid?
The IUPAC name of (2Z)-2-[(2,4-dichlorophenyl)methoxyimino]-3-oxobutanoic acid (CID 88719702) is (2Z)-2-[(2,4-dichlorophenyl)methoxyimino]-3-oxobutanoic acid.
What is the SMILES notation for (2Z)-2-[(2,4-dichlorophenyl)methoxyimino]-3-oxobutanoic acid?
The canonical SMILES for (2Z)-2-[(2,4-dichlorophenyl)methoxyimino]-3-oxobutanoic acid is CC(=O)/C(=N/OCc1ccc(Cl)cc1Cl)C(=O)O.
What is the InChIKey of (2Z)-2-[(2,4-dichlorophenyl)methoxyimino]-3-oxobutanoic acid?
The InChIKey is FGSSRNJGNDMRKW-UVTDQMKNSA-N. The full InChI is InChI=1S/C11H9Cl2NO4/c1-6(15)10(11(16)17)14-18-5-7-2-3-8(12)4-9(7)13/h2-4H,5H2,1H3,(H,16,17)/b14-10-.
What are the key properties of (2Z)-2-[(2,4-dichlorophenyl)methoxyimino]-3-oxobutanoic acid?
(2Z)-2-[(2,4-dichlorophenyl)methoxyimino]-3-oxobutanoic acid has a molecular weight of 290.10 g/mol, XLogP of 2.54, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-[(2,4-dichlorophenyl)methoxyimino]-3-oxobutanoic acid is sourced from PubChem (CID 88719702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).