C12H14Cl2N4O2S — CID 3372799
1-[3-[(2,4-dichlorophenyl)methoxyimino]propanoylamino]-3-methylthiourea (PubChem CID 3372799) has the molecular formula C12H14Cl2N4O2S and a molecular weight of 349.24 g/mol. Its IUPAC name is 1-[3-[(2,4-dichlorophenyl)methoxyimino]propanoylamino]-3-methylthiourea.
| Compound Name | 1-[3-[(2,4-dichlorophenyl)methoxyimino]propanoylamino]-3-methylthiourea |
|---|---|
| PubChem CID | 3372799 |
| Molecular Formula | C12H14Cl2N4O2S |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 1-[3-[(2,4-dichlorophenyl)methoxyimino]propanoylamino]-3-methylthiourea |
| SMILES | CNC(=S)NNC(=O)CC=NOCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl2N4O2S/c1-15-12(21)18-17-11(19)4-5-16-20-7-8-2-3-9(13)6-10(8)14/h2-3,5-6H,4,7H2,1H3,(H,17,19)(H2,15,18,21) |
| InChIKey | DRAGVSONRIRYST-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|