C23H18Cl3NO3 — CID 3739562
3-[(4-chlorophenyl)methoxyimino]-1-[3-[(2,4-dichlorophenyl)methoxy]phenyl]propan-1-one (PubChem CID 3739562) has the molecular formula C23H18Cl3NO3 and a molecular weight of 462.76 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methoxyimino]-1-[3-[(2,4-dichlorophenyl)methoxy]phenyl]propan-1-one.
| Compound Name | 3-[(4-chlorophenyl)methoxyimino]-1-[3-[(2,4-dichlorophenyl)methoxy]phenyl]propan-1-one |
|---|---|
| PubChem CID | 3739562 |
| Molecular Formula | C23H18Cl3NO3 |
| Molecular Weight | 462.76 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | 3-[(4-chlorophenyl)methoxyimino]-1-[3-[(2,4-dichlorophenyl)methoxy]phenyl]propan-1-one |
| SMILES | O=C(CC=NOCc1ccc(Cl)cc1)c1cccc(OCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C23H18Cl3NO3/c24-19-7-4-16(5-8-19)14-30-27-11-10-23(28)17-2-1-3-21(12-17)29-15-18-6-9-20(25)13-22(18)26/h1-9,11-13H,10,14-15H2 |
| InChIKey | FNOYQWSVUNLOTN-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.76 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|