C23H17Cl3FNO3 — CID 6111445
(3Z)-1-[3-[(2-chloro-6-fluorophenyl)methoxy]phenyl]-3-[(2,4-dichlorophenyl)methoxyimino]propan-1-one (PubChem CID 6111445) has the molecular formula C23H17Cl3FNO3 and a molecular weight of 480.75 g/mol. Its IUPAC name is (3Z)-1-[3-[(2-chloro-6-fluorophenyl)methoxy]phenyl]-3-[(2,4-dichlorophenyl)methoxyimino]propan-1-one.
| Compound Name | (3Z)-1-[3-[(2-chloro-6-fluorophenyl)methoxy]phenyl]-3-[(2,4-dichlorophenyl)methoxyimino]propan-1-one |
|---|---|
| PubChem CID | 6111445 |
| Molecular Formula | C23H17Cl3FNO3 |
| Molecular Weight | 480.75 g/mol |
| Exact Mass | 479.03 |
| IUPAC Name | (3Z)-1-[3-[(2-chloro-6-fluorophenyl)methoxy]phenyl]-3-[(2,4-dichlorophenyl)methoxyimino]propan-1-one |
| SMILES | O=C(C/C=N\OCc1ccc(Cl)cc1Cl)c1cccc(OCc2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C23H17Cl3FNO3/c24-17-8-7-16(21(26)12-17)13-31-28-10-9-23(29)15-3-1-4-18(11-15)30-14-19-20(25)5-2-6-22(19)27/h1-8,10-12H,9,13-14H2/b28-10- |
| InChIKey | PEUQQRFCERCIAE-LGUSAWBASA-N |
| XLogP | 7.14 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.75 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|