C20H20ClFN2O2S — CID 126202313
1-[3-[(2-chloro-6-fluorophenyl)methoxy]benzenecarbothioyl]piperidine-4-carboxamide (PubChem CID 126202313) has the molecular formula C20H20ClFN2O2S and a molecular weight of 406.91 g/mol. Its IUPAC name is 1-[3-[(2-chloro-6-fluorophenyl)methoxy]benzenecarbothioyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-[(2-chloro-6-fluorophenyl)methoxy]benzenecarbothioyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126202313 |
| Molecular Formula | C20H20ClFN2O2S |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 1-[3-[(2-chloro-6-fluorophenyl)methoxy]benzenecarbothioyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=S)c2cccc(OCc3c(F)cccc3Cl)c2)CC1 |
| InChI | InChI=1S/C20H20ClFN2O2S/c21-17-5-2-6-18(22)16(17)12-26-15-4-1-3-14(11-15)20(27)24-9-7-13(8-10-24)19(23)25/h1-6,11,13H,7-10,12H2,(H2,23,25) |
| InChIKey | NFDDILIEWRSOHT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|