C20H21BrN2O2S — CID 126213152
1-[4-[(4-bromophenyl)methoxy]benzenecarbothioyl]piperidine-4-carboxamide (PubChem CID 126213152) has the molecular formula C20H21BrN2O2S and a molecular weight of 433.37 g/mol. Its IUPAC name is 1-[4-[(4-bromophenyl)methoxy]benzenecarbothioyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[(4-bromophenyl)methoxy]benzenecarbothioyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126213152 |
| Molecular Formula | C20H21BrN2O2S |
| Molecular Weight | 433.37 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 1-[4-[(4-bromophenyl)methoxy]benzenecarbothioyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=S)c2ccc(OCc3ccc(Br)cc3)cc2)CC1 |
| InChI | InChI=1S/C20H21BrN2O2S/c21-17-5-1-14(2-6-17)13-25-18-7-3-16(4-8-18)20(26)23-11-9-15(10-12-23)19(22)24/h1-8,15H,9-13H2,(H2,22,24) |
| InChIKey | NMMYMECYDCPXNS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|