C18H19FN2O4 — CID 51159283
1-[5-[(4-fluorophenoxy)methyl]furan-2-carbonyl]piperidine-4-carboxamide (PubChem CID 51159283) has the molecular formula C18H19FN2O4 and a molecular weight of 346.36 g/mol. Its IUPAC name is 1-[5-[(4-fluorophenoxy)methyl]furan-2-carbonyl]piperidine-4-carboxamide.
| Compound Name | 1-[5-[(4-fluorophenoxy)methyl]furan-2-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 51159283 |
| Molecular Formula | C18H19FN2O4 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 1-[5-[(4-fluorophenoxy)methyl]furan-2-carbonyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)c2ccc(COc3ccc(F)cc3)o2)CC1 |
| InChI | InChI=1S/C18H19FN2O4/c19-13-1-3-14(4-2-13)24-11-15-5-6-16(25-15)18(23)21-9-7-12(8-10-21)17(20)22/h1-6,12H,7-11H2,(H2,20,22) |
| InChIKey | ANXWBDDNRPFMBO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |