C22H19F2NO4 — CID 134044391
[5-[(4-fluorophenoxy)methyl]furan-2-yl]-[2-(4-fluorophenyl)morpholin-4-yl]methanone (PubChem CID 134044391) has the molecular formula C22H19F2NO4 and a molecular weight of 399.39 g/mol. Its IUPAC name is [5-[(4-fluorophenoxy)methyl]furan-2-yl]-[2-(4-fluorophenyl)morpholin-4-yl]methanone.
| Compound Name | [5-[(4-fluorophenoxy)methyl]furan-2-yl]-[2-(4-fluorophenyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 134044391 |
| Molecular Formula | C22H19F2NO4 |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | [5-[(4-fluorophenoxy)methyl]furan-2-yl]-[2-(4-fluorophenyl)morpholin-4-yl]methanone |
| SMILES | O=C(c1ccc(COc2ccc(F)cc2)o1)N1CCOC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H19F2NO4/c23-16-3-1-15(2-4-16)21-13-25(11-12-27-21)22(26)20-10-9-19(29-20)14-28-18-7-5-17(24)6-8-18/h1-10,21H,11-14H2 |
| InChIKey | RXZGRILFNXXAQE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |